C10H22N2O7S2 — CID 129167583
2-[1-[2-(propan-2-ylsulfonylamino)ethoxy]propan-2-ylsulfonylamino]acetic acid (PubChem CID 129167583) has the molecular formula C10H22N2O7S2 and a molecular weight of 346.43 g/mol. Its IUPAC name is 2-[1-[2-(propan-2-ylsulfonylamino)ethoxy]propan-2-ylsulfonylamino]acetic acid.
| Compound Name | 2-[1-[2-(propan-2-ylsulfonylamino)ethoxy]propan-2-ylsulfonylamino]acetic acid |
|---|---|
| PubChem CID | 129167583 |
| Molecular Formula | C10H22N2O7S2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 2-[1-[2-(propan-2-ylsulfonylamino)ethoxy]propan-2-ylsulfonylamino]acetic acid |
| SMILES | CC(C)S(=O)(=O)NCCOCC(C)S(=O)(=O)NCC(=O)O |
| InChI | InChI=1S/C10H22N2O7S2/c1-8(2)20(15,16)11-4-5-19-7-9(3)21(17,18)12-6-10(13)14/h8-9,11-12H,4-7H2,1-3H3,(H,13,14) |
| InChIKey | GMXVORVPMNGFCY-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 138.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|