C24H21FN4O5 — CID 126491911
methyl 2-[5-[4-(4-cyanophenyl)piperazin-1-yl]-5-oxopent-1-ynyl]-5-fluoro-3-nitrobenzoate (PubChem CID 126491911) has the molecular formula C24H21FN4O5 and a molecular weight of 464.45 g/mol. Its IUPAC name is methyl 2-[5-[4-(4-cyanophenyl)piperazin-1-yl]-5-oxopent-1-ynyl]-5-fluoro-3-nitrobenzoate.
| Compound Name | methyl 2-[5-[4-(4-cyanophenyl)piperazin-1-yl]-5-oxopent-1-ynyl]-5-fluoro-3-nitrobenzoate |
|---|---|
| PubChem CID | 126491911 |
| Molecular Formula | C24H21FN4O5 |
| Molecular Weight | 464.45 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | methyl 2-[5-[4-(4-cyanophenyl)piperazin-1-yl]-5-oxopent-1-ynyl]-5-fluoro-3-nitrobenzoate |
| SMILES | COC(=O)c1cc(F)cc([N+](=O)[O-])c1C#CCCC(=O)N1CCN(c2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C24H21FN4O5/c1-34-24(31)21-14-18(25)15-22(29(32)33)20(21)4-2-3-5-23(30)28-12-10-27(11-13-28)19-8-6-17(16-26)7-9-19/h6-9,14-15H,3,5,10-13H2,1H3 |
| InChIKey | SXRGYGPWHRAHIX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 116.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.45 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|