C14H23NO5 — CID 126492245
4-O-[2-[2,2-dimethylpropanoyl(methyl)amino]ethyl] 1-O-ethyl (E)-but-2-enedioate (PubChem CID 126492245) has the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. Its IUPAC name is 4-O-[2-[2,2-dimethylpropanoyl(methyl)amino]ethyl] 1-O-ethyl (E)-but-2-enedioate.
| Compound Name | 4-O-[2-[2,2-dimethylpropanoyl(methyl)amino]ethyl] 1-O-ethyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 126492245 |
| Molecular Formula | C14H23NO5 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 4-O-[2-[2,2-dimethylpropanoyl(methyl)amino]ethyl] 1-O-ethyl (E)-but-2-enedioate |
| SMILES | CCOC(=O)/C=C/C(=O)OCCN(C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C14H23NO5/c1-6-19-11(16)7-8-12(17)20-10-9-15(5)13(18)14(2,3)4/h7-8H,6,9-10H2,1-5H3/b8-7+ |
| InChIKey | LZWYIRHOQVIRMS-BQYQJAHWSA-N |
| XLogP | 1.15 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|