C24H30N4 — CID 126494248
7-tert-butyl-6-methyl-3-[2-methyl-2-(5-methyl-1H-indazol-4-yl)propyl]-2H-indazole (PubChem CID 126494248) has the molecular formula C24H30N4 and a molecular weight of 374.53 g/mol. Its IUPAC name is 7-tert-butyl-6-methyl-3-[2-methyl-2-(5-methyl-1H-indazol-4-yl)propyl]-2H-indazole.
| Compound Name | 7-tert-butyl-6-methyl-3-[2-methyl-2-(5-methyl-1H-indazol-4-yl)propyl]-2H-indazole |
|---|---|
| PubChem CID | 126494248 |
| Molecular Formula | C24H30N4 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | 7-tert-butyl-6-methyl-3-[2-methyl-2-(5-methyl-1H-indazol-4-yl)propyl]-2H-indazole |
| SMILES | Cc1ccc2[nH]ncc2c1C(C)(C)Cc1[nH]nc2c(C(C)(C)C)c(C)ccc12 |
| InChI | InChI=1S/C24H30N4/c1-14-9-11-18-17(13-25-26-18)20(14)24(6,7)12-19-16-10-8-15(2)21(23(3,4)5)22(16)28-27-19/h8-11,13H,12H2,1-7H3,(H,25,26)(H,27,28) |
| InChIKey | AXCZJFAUWMSGHU-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |