C26H32N2O — CID 162239352
4-tert-butyl-5-methyl-1H-indazole;4-tert-butylnaphthalen-2-ol (PubChem CID 162239352) has the molecular formula C26H32N2O and a molecular weight of 388.56 g/mol. Its IUPAC name is 4-tert-butyl-5-methyl-1H-indazole;4-tert-butylnaphthalen-2-ol.
| Compound Name | 4-tert-butyl-5-methyl-1H-indazole;4-tert-butylnaphthalen-2-ol |
|---|---|
| PubChem CID | 162239352 |
| Molecular Formula | C26H32N2O |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | 4-tert-butyl-5-methyl-1H-indazole;4-tert-butylnaphthalen-2-ol |
| SMILES | CC(C)(C)c1cc(O)cc2ccccc12.Cc1ccc2[nH]ncc2c1C(C)(C)C |
| InChI | InChI=1S/C14H16O.C12H16N2/c1-14(2,3)13-9-11(15)8-10-6-4-5-7-12(10)13;1-8-5-6-10-9(7-13-14-10)11(8)12(2,3)4/h4-9,15H,1-3H3;5-7H,1-4H3,(H,13,14) |
| InChIKey | ZWMLDKHPGQRAIP-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |