C12H19O4P — CID 126494295
(3-tert-butylphenyl)methoxymethylphosphonic acid (PubChem CID 126494295) has the molecular formula C12H19O4P and a molecular weight of 258.25 g/mol. Its IUPAC name is (3-tert-butylphenyl)methoxymethylphosphonic acid.
| Compound Name | (3-tert-butylphenyl)methoxymethylphosphonic acid |
|---|---|
| PubChem CID | 126494295 |
| Molecular Formula | C12H19O4P |
| Molecular Weight | 258.25 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | (3-tert-butylphenyl)methoxymethylphosphonic acid |
| SMILES | CC(C)(C)c1cccc(COCP(=O)(O)O)c1 |
| InChI | InChI=1S/C12H19O4P/c1-12(2,3)11-6-4-5-10(7-11)8-16-9-17(13,14)15/h4-7H,8-9H2,1-3H3,(H2,13,14,15) |
| InChIKey | PBMCQXMJWLDBMH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.25 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|