C22H41N3O8 — CID 126494554
4-amino-5-dodecanoyloxy-5-oxopentanoic acid;2,5-diamino-5-oxopentanoic acid (PubChem CID 126494554) has the molecular formula C22H41N3O8 and a molecular weight of 475.58 g/mol. Its IUPAC name is 4-amino-5-dodecanoyloxy-5-oxopentanoic acid;2,5-diamino-5-oxopentanoic acid.
| Compound Name | 4-amino-5-dodecanoyloxy-5-oxopentanoic acid;2,5-diamino-5-oxopentanoic acid |
|---|---|
| PubChem CID | 126494554 |
| Molecular Formula | C22H41N3O8 |
| Molecular Weight | 475.58 g/mol |
| Exact Mass | 475.29 |
| IUPAC Name | 4-amino-5-dodecanoyloxy-5-oxopentanoic acid;2,5-diamino-5-oxopentanoic acid |
| SMILES | CCCCCCCCCCCC(=O)OC(=O)C(N)CCC(=O)O.NC(=O)CCC(N)C(=O)O |
| InChI | InChI=1S/C17H31NO5.C5H10N2O3/c1-2-3-4-5-6-7-8-9-10-11-16(21)23-17(22)14(18)12-13-15(19)20;6-3(5(9)10)1-2-4(7)8/h14H,2-13,18H2,1H3,(H,19,20);3H,1-2,6H2,(H2,7,8)(H,9,10) |
| InChIKey | GRRIJQYABLJULD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 213.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.58 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|