C83H80N4 — CID 126498124
5-N,9-N-bis[3-(3,6-ditert-butylcarbazol-9-yl)phenyl]-7,7-dimethyl-5-N,9-N-diphenylbenzo[c]fluorene-5,9-diamine (PubChem CID 126498124) has the molecular formula C83H80N4 and a molecular weight of 1133.58 g/mol. Its IUPAC name is 5-N,9-N-bis[3-(3,6-ditert-butylcarbazol-9-yl)phenyl]-7,7-dimethyl-5-N,9-N-diphenylbenzo[c]fluorene-5,9-diamine.
| Compound Name | 5-N,9-N-bis[3-(3,6-ditert-butylcarbazol-9-yl)phenyl]-7,7-dimethyl-5-N,9-N-diphenylbenzo[c]fluorene-5,9-diamine |
|---|---|
| PubChem CID | 126498124 |
| Molecular Formula | C83H80N4 |
| Molecular Weight | 1133.58 g/mol |
| Exact Mass | 1132.64 |
| IUPAC Name | 5-N,9-N-bis[3-(3,6-ditert-butylcarbazol-9-yl)phenyl]-7,7-dimethyl-5-N,9-N-diphenylbenzo[c]fluorene-5,9-diamine |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1cccc(N(c2ccccc2)c2ccc3c(c2)C(C)(C)c2cc(N(c4ccccc4)c4cccc(-n5c6ccc(C(C)(C)C)cc6c6cc(C(C)(C)C)ccc65)c4)c4ccccc4c2-3)c1 |
| InChI | InChI=1S/C83H80N4/c1-79(2,3)53-35-41-73-67(45-53)68-46-54(80(4,5)6)36-42-74(68)86(73)61-31-23-29-59(49-61)84(57-25-17-15-18-26-57)63-39-40-66-71(51-63)83(13,14)72-52-77(64-33-21-22-34-65(64)78(66)72)85(58-27-19-16-20-28-58)60-30-24-32-62(50-60)87-75-43-37-55(81(7,8)9)47-69(75)70-48-56(82(10,11)12)38-44-76(70)87/h15-52H,1-14H3 |
| InChIKey | VSWQCMDIZDNVBP-UHFFFAOYSA-N |
| XLogP | 23.47 |
| TPSA | 16.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 87 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1133.58 |
| LogP ≤ 5 | 23.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |