C55H62N2 — CID 66805214
2-tert-butyl-N,N,5-tris(4-tert-butylphenyl)-7,7-dimethylindeno[2,1-b]carbazol-9-amine (PubChem CID 66805214) has the molecular formula C55H62N2 and a molecular weight of 751.11 g/mol. Its IUPAC name is 2-tert-butyl-N,N,5-tris(4-tert-butylphenyl)-7,7-dimethylindeno[2,1-b]carbazol-9-amine.
| Compound Name | 2-tert-butyl-N,N,5-tris(4-tert-butylphenyl)-7,7-dimethylindeno[2,1-b]carbazol-9-amine |
|---|---|
| PubChem CID | 66805214 |
| Molecular Formula | C55H62N2 |
| Molecular Weight | 751.11 g/mol |
| Exact Mass | 750.49 |
| IUPAC Name | 2-tert-butyl-N,N,5-tris(4-tert-butylphenyl)-7,7-dimethylindeno[2,1-b]carbazol-9-amine |
| SMILES | CC(C)(C)c1ccc(N(c2ccc(C(C)(C)C)cc2)c2ccc3c(c2)C(C)(C)c2cc4c(cc2-3)c2cc(C(C)(C)C)ccc2n4-c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C55H62N2/c1-51(2,3)35-15-22-39(23-16-35)56(40-24-17-36(18-25-40)52(4,5)6)42-28-29-43-44-33-46-45-31-38(54(10,11)12)21-30-49(45)57(41-26-19-37(20-27-41)53(7,8)9)50(46)34-48(44)55(13,14)47(43)32-42/h15-34H,1-14H3 |
| InChIKey | JTJHXWDPJZWWDW-UHFFFAOYSA-N |
| XLogP | 15.75 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.11 |
| LogP ≤ 5 | 15.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |