C67H54N4 — CID 58969350
2-N,7-N-bis[4-(3,6-dimethylcarbazol-9-yl)phenyl]-9,9-dimethyl-2-N,7-N-diphenylfluorene-2,7-diamine (PubChem CID 58969350) has the molecular formula C67H54N4 and a molecular weight of 915.20 g/mol. Its IUPAC name is 2-N,7-N-bis[4-(3,6-dimethylcarbazol-9-yl)phenyl]-9,9-dimethyl-2-N,7-N-diphenylfluorene-2,7-diamine.
| Compound Name | 2-N,7-N-bis[4-(3,6-dimethylcarbazol-9-yl)phenyl]-9,9-dimethyl-2-N,7-N-diphenylfluorene-2,7-diamine |
|---|---|
| PubChem CID | 58969350 |
| Molecular Formula | C67H54N4 |
| Molecular Weight | 915.20 g/mol |
| Exact Mass | 914.43 |
| IUPAC Name | 2-N,7-N-bis[4-(3,6-dimethylcarbazol-9-yl)phenyl]-9,9-dimethyl-2-N,7-N-diphenylfluorene-2,7-diamine |
| SMILES | Cc1ccc2c(c1)c1cc(C)ccc1n2-c1ccc(N(c2ccccc2)c2ccc3c(c2)C(C)(C)c2cc(N(c4ccccc4)c4ccc(-n5c6ccc(C)cc6c6cc(C)ccc65)cc4)ccc2-3)cc1 |
| InChI | InChI=1S/C67H54N4/c1-43-17-33-63-57(37-43)58-38-44(2)18-34-64(58)70(63)51-25-21-49(22-26-51)68(47-13-9-7-10-14-47)53-29-31-55-56-32-30-54(42-62(56)67(5,6)61(55)41-53)69(48-15-11-8-12-16-48)50-23-27-52(28-24-50)71-65-35-19-45(3)39-59(65)60-40-46(4)20-36-66(60)71/h7-42H,1-6H3 |
| InChIKey | UCHISXMCMARHLM-UHFFFAOYSA-N |
| XLogP | 18.36 |
| TPSA | 16.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 915.20 |
| LogP ≤ 5 | 18.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |