C48H40N2 — CID 58383998
N-[4-(9,9-dimethylfluoren-2-yl)phenyl]-6-methyl-N,9-bis(4-methylphenyl)carbazol-3-amine (PubChem CID 58383998) has the molecular formula C48H40N2 and a molecular weight of 644.86 g/mol. Its IUPAC name is N-[4-(9,9-dimethylfluoren-2-yl)phenyl]-6-methyl-N,9-bis(4-methylphenyl)carbazol-3-amine.
| Compound Name | N-[4-(9,9-dimethylfluoren-2-yl)phenyl]-6-methyl-N,9-bis(4-methylphenyl)carbazol-3-amine |
|---|---|
| PubChem CID | 58383998 |
| Molecular Formula | C48H40N2 |
| Molecular Weight | 644.86 g/mol |
| Exact Mass | 644.32 |
| IUPAC Name | N-[4-(9,9-dimethylfluoren-2-yl)phenyl]-6-methyl-N,9-bis(4-methylphenyl)carbazol-3-amine |
| SMILES | Cc1ccc(N(c2ccc(-c3ccc4c(c3)C(C)(C)c3ccccc3-4)cc2)c2ccc3c(c2)c2cc(C)ccc2n3-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C48H40N2/c1-31-10-18-36(19-11-31)49(37-22-15-34(16-23-37)35-17-25-41-40-8-6-7-9-44(40)48(4,5)45(41)29-35)39-24-27-47-43(30-39)42-28-33(3)14-26-46(42)50(47)38-20-12-32(2)13-21-38/h6-30H,1-5H3 |
| InChIKey | BSNZIXPAWZXPLE-UHFFFAOYSA-N |
| XLogP | 13.15 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.86 |
| LogP ≤ 5 | 13.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |