C64H56N2 — CID 121355720
2-tert-butyl-5-[6-(2-tert-butyl-7,7-dimethylindeno[2,1-b]carbazol-5-yl)anthracen-2-yl]-7,7-dimethylindeno[2,1-b]carbazole (PubChem CID 121355720) has the molecular formula C64H56N2 and a molecular weight of 853.17 g/mol. Its IUPAC name is 2-tert-butyl-5-[6-(2-tert-butyl-7,7-dimethylindeno[2,1-b]carbazol-5-yl)anthracen-2-yl]-7,7-dimethylindeno[2,1-b]carbazole.
| Compound Name | 2-tert-butyl-5-[6-(2-tert-butyl-7,7-dimethylindeno[2,1-b]carbazol-5-yl)anthracen-2-yl]-7,7-dimethylindeno[2,1-b]carbazole |
|---|---|
| PubChem CID | 121355720 |
| Molecular Formula | C64H56N2 |
| Molecular Weight | 853.17 g/mol |
| Exact Mass | 852.44 |
| IUPAC Name | 2-tert-butyl-5-[6-(2-tert-butyl-7,7-dimethylindeno[2,1-b]carbazol-5-yl)anthracen-2-yl]-7,7-dimethylindeno[2,1-b]carbazole |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc3c(cc1n2-c1ccc2cc4cc(-n5c6ccc(C(C)(C)C)cc6c6cc7c(cc65)C(C)(C)c5ccccc5-7)ccc4cc2c1)C(C)(C)c1ccccc1-3 |
| InChI | InChI=1S/C64H56N2/c1-61(2,3)41-21-25-57-49(31-41)51-33-47-45-15-11-13-17-53(45)63(7,8)55(47)35-59(51)65(57)43-23-19-37-28-40-30-44(24-20-38(40)27-39(37)29-43)66-58-26-22-42(62(4,5)6)32-50(58)52-34-48-46-16-12-14-18-54(46)64(9,10)56(48)36-60(52)66/h11-36H,1-10H3 |
| InChIKey | ZQEGVLRILFRTBO-UHFFFAOYSA-N |
| XLogP | 17.39 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.17 |
| LogP ≤ 5 | 17.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|