C32H30FN3O5 — CID 126499244
2-[4-fluoro-5-[[6-[[(1S)-1-(4-nitrophenyl)ethyl]carbamoyl]-3,4-dihydro-2H-quinolin-1-yl]methyl]cyclohexa-2,4-dien-1-yl]benzoic acid (PubChem CID 126499244) has the molecular formula C32H30FN3O5 and a molecular weight of 555.61 g/mol. Its IUPAC name is 2-[4-fluoro-5-[[6-[[(1S)-1-(4-nitrophenyl)ethyl]carbamoyl]-3,4-dihydro-2H-quinolin-1-yl]methyl]cyclohexa-2,4-dien-1-yl]benzoic acid.
| Compound Name | 2-[4-fluoro-5-[[6-[[(1S)-1-(4-nitrophenyl)ethyl]carbamoyl]-3,4-dihydro-2H-quinolin-1-yl]methyl]cyclohexa-2,4-dien-1-yl]benzoic acid |
|---|---|
| PubChem CID | 126499244 |
| Molecular Formula | C32H30FN3O5 |
| Molecular Weight | 555.61 g/mol |
| Exact Mass | 555.22 |
| IUPAC Name | 2-[4-fluoro-5-[[6-[[(1S)-1-(4-nitrophenyl)ethyl]carbamoyl]-3,4-dihydro-2H-quinolin-1-yl]methyl]cyclohexa-2,4-dien-1-yl]benzoic acid |
| SMILES | C[C@H](NC(=O)c1ccc2c(c1)CCCN2CC1=C(F)C=CC(c2ccccc2C(=O)O)C1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C32H30FN3O5/c1-20(21-8-12-26(13-9-21)36(40)41)34-31(37)24-11-15-30-23(18-24)5-4-16-35(30)19-25-17-22(10-14-29(25)33)27-6-2-3-7-28(27)32(38)39/h2-3,6-15,18,20,22H,4-5,16-17,19H2,1H3,(H,34,37)(H,38,39)/t20-,22?/m0/s1 |
| InChIKey | PHLIRTHCAWTWRP-AIBWNMTMSA-N |
| XLogP | 6.50 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.61 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|