C26H27N5O4 — CID 60513340
3-nitro-N-[1-[4-(phenylcarbamoylamino)phenyl]ethyl]-4-pyrrolidin-1-ylbenzamide (PubChem CID 60513340) has the molecular formula C26H27N5O4 and a molecular weight of 473.53 g/mol. Its IUPAC name is 3-nitro-N-[1-[4-(phenylcarbamoylamino)phenyl]ethyl]-4-pyrrolidin-1-ylbenzamide.
| Compound Name | 3-nitro-N-[1-[4-(phenylcarbamoylamino)phenyl]ethyl]-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 60513340 |
| Molecular Formula | C26H27N5O4 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | 3-nitro-N-[1-[4-(phenylcarbamoylamino)phenyl]ethyl]-4-pyrrolidin-1-ylbenzamide |
| SMILES | CC(NC(=O)c1ccc(N2CCCC2)c([N+](=O)[O-])c1)c1ccc(NC(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C26H27N5O4/c1-18(19-9-12-22(13-10-19)29-26(33)28-21-7-3-2-4-8-21)27-25(32)20-11-14-23(24(17-20)31(34)35)30-15-5-6-16-30/h2-4,7-14,17-18H,5-6,15-16H2,1H3,(H,27,32)(H2,28,29,33) |
| InChIKey | XTMXTDKQLMDNAS-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|