C30H41N3O7 — CID 126499516
[(4E,6Z,9S,10E,14R,16R)-8,14-dimethoxy-4,10,16-trimethyl-3,20,22-trioxo-19-(prop-2-enylamino)-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate (PubChem CID 126499516) has the molecular formula C30H41N3O7 and a molecular weight of 555.67 g/mol. Its IUPAC name is [(4E,6Z,9S,10E,14R,16R)-8,14-dimethoxy-4,10,16-trimethyl-3,20,22-trioxo-19-(prop-2-enylamino)-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate.
| Compound Name | [(4E,6Z,9S,10E,14R,16R)-8,14-dimethoxy-4,10,16-trimethyl-3,20,22-trioxo-19-(prop-2-enylamino)-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate |
|---|---|
| PubChem CID | 126499516 |
| Molecular Formula | C30H41N3O7 |
| Molecular Weight | 555.67 g/mol |
| Exact Mass | 555.29 |
| IUPAC Name | [(4E,6Z,9S,10E,14R,16R)-8,14-dimethoxy-4,10,16-trimethyl-3,20,22-trioxo-19-(prop-2-enylamino)-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate |
| SMILES | C=CCNC1=C2C[C@@H](C)C[C@H](OC)CC/C=C(\C)[C@H](OC(N)=O)C(OC)/C=C\C=C(/C)C(=O)NC(=CC1=O)C2=O |
| InChI | InChI=1S/C30H41N3O7/c1-7-14-32-26-22-16-18(2)15-21(38-5)12-8-10-19(3)28(40-30(31)37)25(39-6)13-9-11-20(4)29(36)33-23(27(22)35)17-24(26)34/h7,9-11,13,17-18,21,25,28,32H,1,8,12,14-16H2,2-6H3,(H2,31,37)(H,33,36)/b13-9-,19-10+,20-11+/t18-,21+,25?,28-/m0/s1 |
| InChIKey | NCDHTJPBMSZOOI-JGDOXNSISA-N |
| XLogP | 3.32 |
| TPSA | 146.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.67 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|