C30H41N3O8 — CID 89040252
[(4E,6Z,10E,13R)-13-hydroxy-8,14-dimethoxy-4,10,16-trimethyl-3,20,22-trioxo-19-(prop-2-enylamino)-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate (PubChem CID 89040252) has the molecular formula C30H41N3O8 and a molecular weight of 571.67 g/mol. Its IUPAC name is [(4E,6Z,10E,13R)-13-hydroxy-8,14-dimethoxy-4,10,16-trimethyl-3,20,22-trioxo-19-(prop-2-enylamino)-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate.
| Compound Name | [(4E,6Z,10E,13R)-13-hydroxy-8,14-dimethoxy-4,10,16-trimethyl-3,20,22-trioxo-19-(prop-2-enylamino)-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate |
|---|---|
| PubChem CID | 89040252 |
| Molecular Formula | C30H41N3O8 |
| Molecular Weight | 571.67 g/mol |
| Exact Mass | 571.29 |
| IUPAC Name | [(4E,6Z,10E,13R)-13-hydroxy-8,14-dimethoxy-4,10,16-trimethyl-3,20,22-trioxo-19-(prop-2-enylamino)-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate |
| SMILES | C=CCNC1=C2CC(C)CC(OC)[C@H](O)C/C=C(\C)C(OC(N)=O)C(OC)/C=C\C=C(/C)C(=O)NC(=CC1=O)C2=O |
| InChI | InChI=1S/C30H41N3O8/c1-7-13-32-26-20-14-17(2)15-25(40-6)22(34)12-11-18(3)28(41-30(31)38)24(39-5)10-8-9-19(4)29(37)33-21(27(20)36)16-23(26)35/h7-11,16-17,22,24-25,28,32,34H,1,12-15H2,2-6H3,(H2,31,38)(H,33,37)/b10-8-,18-11+,19-9+/t17?,22-,24?,25?,28?/m1/s1 |
| InChIKey | LHFLCQOYGYLCKW-XAPBZWSWSA-N |
| XLogP | 2.29 |
| TPSA | 166.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.67 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|