C14H17FN4 — CID 126499908
3-ethyl-N-(3-fluoro-4-pyridinyl)-N',1-dimethylpyrrole-2-carboximidamide (PubChem CID 126499908) has the molecular formula C14H17FN4 and a molecular weight of 260.32 g/mol. Its IUPAC name is 3-ethyl-N-(3-fluoro-4-pyridinyl)-N',1-dimethylpyrrole-2-carboximidamide.
| Compound Name | 3-ethyl-N-(3-fluoro-4-pyridinyl)-N',1-dimethylpyrrole-2-carboximidamide |
|---|---|
| PubChem CID | 126499908 |
| Molecular Formula | C14H17FN4 |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 3-ethyl-N-(3-fluoro-4-pyridinyl)-N',1-dimethylpyrrole-2-carboximidamide |
| SMILES | CCc1ccn(C)c1/C(=N\C)Nc1ccncc1F |
| InChI | InChI=1S/C14H17FN4/c1-4-10-6-8-19(3)13(10)14(16-2)18-12-5-7-17-9-11(12)15/h5-9H,4H2,1-3H3,(H,16,17,18) |
| InChIKey | JSUGOCAEOKCBBT-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|