C21H25F3N6O2 — CID 126500513
4-[[(1R,4S)-4-hydroxy-3,3-dimethylcyclohexyl]amino]-2-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methylamino]pyrimidine-5-carbonitrile (PubChem CID 126500513) has the molecular formula C21H25F3N6O2 and a molecular weight of 450.47 g/mol. Its IUPAC name is 4-[[(1R,4S)-4-hydroxy-3,3-dimethylcyclohexyl]amino]-2-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methylamino]pyrimidine-5-carbonitrile.
| Compound Name | 4-[[(1R,4S)-4-hydroxy-3,3-dimethylcyclohexyl]amino]-2-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methylamino]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 126500513 |
| Molecular Formula | C21H25F3N6O2 |
| Molecular Weight | 450.47 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | 4-[[(1R,4S)-4-hydroxy-3,3-dimethylcyclohexyl]amino]-2-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methylamino]pyrimidine-5-carbonitrile |
| SMILES | CC1(C)C[C@H](Nc2nc(NCc3cccnc3OCC(F)(F)F)ncc2C#N)CC[C@@H]1O |
| InChI | InChI=1S/C21H25F3N6O2/c1-20(2)8-15(5-6-16(20)31)29-17-14(9-25)11-28-19(30-17)27-10-13-4-3-7-26-18(13)32-12-21(22,23)24/h3-4,7,11,15-16,31H,5-6,8,10,12H2,1-2H3,(H2,27,28,29,30)/t15-,16+/m1/s1 |
| InChIKey | ICZBIFWFQAJBIX-CVEARBPZSA-N |
| XLogP | 3.65 |
| TPSA | 115.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |