C69H84F6O2 — CID 126501914
9-(2,2-difluorooctyl)-2,7-bis[4-(4-octoxyphenyl)phenyl]-9-(1,1,2,2-tetrafluorooctyl)fluorene (PubChem CID 126501914) has the molecular formula C69H84F6O2 and a molecular weight of 1059.42 g/mol. Its IUPAC name is 9-(2,2-difluorooctyl)-2,7-bis[4-(4-octoxyphenyl)phenyl]-9-(1,1,2,2-tetrafluorooctyl)fluorene.
| Compound Name | 9-(2,2-difluorooctyl)-2,7-bis[4-(4-octoxyphenyl)phenyl]-9-(1,1,2,2-tetrafluorooctyl)fluorene |
|---|---|
| PubChem CID | 126501914 |
| Molecular Formula | C69H84F6O2 |
| Molecular Weight | 1059.42 g/mol |
| Exact Mass | 1058.64 |
| IUPAC Name | 9-(2,2-difluorooctyl)-2,7-bis[4-(4-octoxyphenyl)phenyl]-9-(1,1,2,2-tetrafluorooctyl)fluorene |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(-c3ccc4c(c3)C(CC(F)(F)CCCCCC)(C(F)(F)C(F)(F)CCCCCC)c3cc(-c5ccc(-c6ccc(OCCCCCCCC)cc6)cc5)ccc3-4)cc2)cc1 |
| InChI | InChI=1S/C69H84F6O2/c1-5-9-13-17-19-23-47-76-60-39-33-54(34-40-60)52-25-29-56(30-26-52)58-37-43-62-63-44-38-59(57-31-27-53(28-32-57)55-35-41-61(42-36-55)77-48-24-20-18-14-10-6-2)50-65(63)67(64(62)49-58,51-66(70,71)45-21-15-11-7-3)69(74,75)68(72,73)46-22-16-12-8-4/h25-44,49-50H,5-24,45-48,51H2,1-4H3 |
| InChIKey | PWODJVCRVSNQNY-UHFFFAOYSA-N |
| XLogP | 22.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1059.42 |
| LogP ≤ 5 | 22.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|