C32H38FNO — CID 126502010
(1S,2R,5S,6R,14S,16R)-N-(2-fluoroethyl)-N,6-dimethyl-5-naphthalen-2-yl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-dien-14-amine (PubChem CID 126502010) has the molecular formula C32H38FNO and a molecular weight of 471.66 g/mol. Its IUPAC name is (1S,2R,5S,6R,14S,16R)-N-(2-fluoroethyl)-N,6-dimethyl-5-naphthalen-2-yl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-dien-14-amine.
| Compound Name | (1S,2R,5S,6R,14S,16R)-N-(2-fluoroethyl)-N,6-dimethyl-5-naphthalen-2-yl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-dien-14-amine |
|---|---|
| PubChem CID | 126502010 |
| Molecular Formula | C32H38FNO |
| Molecular Weight | 471.66 g/mol |
| Exact Mass | 471.29 |
| IUPAC Name | (1S,2R,5S,6R,14S,16R)-N-(2-fluoroethyl)-N,6-dimethyl-5-naphthalen-2-yl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-8,10-dien-14-amine |
| SMILES | CN(CCF)[C@H]1CCC2=CC3=CC[C@]4(C)[C@@H](c5ccc6ccccc6c5)CC[C@H]4[C@@]34CC[C@]2(C1)O4 |
| InChI | InChI=1S/C32H38FNO/c1-30-14-13-26-20-25-9-10-27(34(2)18-17-33)21-31(25)15-16-32(26,35-31)29(30)12-11-28(30)24-8-7-22-5-3-4-6-23(22)19-24/h3-8,13,19-20,27-29H,9-12,14-18,21H2,1-2H3/t27-,28+,29+,30+,31+,32+/m0/s1 |
| InChIKey | DEDYMPRYASRBSY-YWTMIQCDSA-N |
| XLogP | 7.35 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.66 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |