C31H31ClF3N3OS — CID 126503096
2-[3-[[7-(4-chloro-3-methylphenyl)-1-(4-fluorophenyl)-4,5,6,7-tetrahydrobenzimidazol-2-yl]sulfanylmethyl]-2,4-difluorophenoxy]-N,N-dimethylethanamine (PubChem CID 126503096) has the molecular formula C31H31ClF3N3OS and a molecular weight of 586.12 g/mol. Its IUPAC name is 2-[3-[[7-(4-chloro-3-methylphenyl)-1-(4-fluorophenyl)-4,5,6,7-tetrahydrobenzimidazol-2-yl]sulfanylmethyl]-2,4-difluorophenoxy]-N,N-dimethylethanamine.
| Compound Name | 2-[3-[[7-(4-chloro-3-methylphenyl)-1-(4-fluorophenyl)-4,5,6,7-tetrahydrobenzimidazol-2-yl]sulfanylmethyl]-2,4-difluorophenoxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 126503096 |
| Molecular Formula | C31H31ClF3N3OS |
| Molecular Weight | 586.12 g/mol |
| Exact Mass | 585.18 |
| IUPAC Name | 2-[3-[[7-(4-chloro-3-methylphenyl)-1-(4-fluorophenyl)-4,5,6,7-tetrahydrobenzimidazol-2-yl]sulfanylmethyl]-2,4-difluorophenoxy]-N,N-dimethylethanamine |
| SMILES | Cc1cc(C2CCCc3nc(SCc4c(F)ccc(OCCN(C)C)c4F)n(-c4ccc(F)cc4)c32)ccc1Cl |
| InChI | InChI=1S/C31H31ClF3N3OS/c1-19-17-20(7-12-25(19)32)23-5-4-6-27-30(23)38(22-10-8-21(33)9-11-22)31(36-27)40-18-24-26(34)13-14-28(29(24)35)39-16-15-37(2)3/h7-14,17,23H,4-6,15-16,18H2,1-3H3 |
| InChIKey | WPXFMZVPSCWWPF-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.12 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |