C32H33ClF3N5S — CID 126503302
1-[3-[4-[[7-(4-chloro-3-methylphenyl)-1-(4-fluorophenyl)-4,5,6,7-tetrahydrobenzimidazol-2-yl]sulfanylmethyl]-3,5-difluorophenyl]propyl]-2-methylguanidine (PubChem CID 126503302) has the molecular formula C32H33ClF3N5S and a molecular weight of 612.17 g/mol. Its IUPAC name is 1-[3-[4-[[7-(4-chloro-3-methylphenyl)-1-(4-fluorophenyl)-4,5,6,7-tetrahydrobenzimidazol-2-yl]sulfanylmethyl]-3,5-difluorophenyl]propyl]-2-methylguanidine.
| Compound Name | 1-[3-[4-[[7-(4-chloro-3-methylphenyl)-1-(4-fluorophenyl)-4,5,6,7-tetrahydrobenzimidazol-2-yl]sulfanylmethyl]-3,5-difluorophenyl]propyl]-2-methylguanidine |
|---|---|
| PubChem CID | 126503302 |
| Molecular Formula | C32H33ClF3N5S |
| Molecular Weight | 612.17 g/mol |
| Exact Mass | 611.21 |
| IUPAC Name | 1-[3-[4-[[7-(4-chloro-3-methylphenyl)-1-(4-fluorophenyl)-4,5,6,7-tetrahydrobenzimidazol-2-yl]sulfanylmethyl]-3,5-difluorophenyl]propyl]-2-methylguanidine |
| SMILES | C/N=C(\N)NCCCc1cc(F)c(CSc2nc3c(n2-c2ccc(F)cc2)C(c2ccc(Cl)c(C)c2)CCC3)c(F)c1 |
| InChI | InChI=1S/C32H33ClF3N5S/c1-19-15-21(8-13-26(19)33)24-6-3-7-29-30(24)41(23-11-9-22(34)10-12-23)32(40-29)42-18-25-27(35)16-20(17-28(25)36)5-4-14-39-31(37)38-2/h8-13,15-17,24H,3-7,14,18H2,1-2H3,(H3,37,38,39) |
| InChIKey | PMIZFIUFVYIJCS-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.17 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|