C32H31Cl2F3N6OS — CID 126505880
2-[3-[4-[[7-(4-chloro-3-methoxyphenyl)-1-(4-fluorophenyl)-4,5,6,7-tetrahydrobenzimidazol-2-yl]sulfanylmethyl]-3,5-difluorophenyl]propyl]-1-cyanoguanidine;hydrochloride (PubChem CID 126505880) has the molecular formula C32H31Cl2F3N6OS and a molecular weight of 675.61 g/mol. Its IUPAC name is 2-[3-[4-[[7-(4-chloro-3-methoxyphenyl)-1-(4-fluorophenyl)-4,5,6,7-tetrahydrobenzimidazol-2-yl]sulfanylmethyl]-3,5-difluorophenyl]propyl]-1-cyanoguanidine;hydrochloride.
| Compound Name | 2-[3-[4-[[7-(4-chloro-3-methoxyphenyl)-1-(4-fluorophenyl)-4,5,6,7-tetrahydrobenzimidazol-2-yl]sulfanylmethyl]-3,5-difluorophenyl]propyl]-1-cyanoguanidine;hydrochloride |
|---|---|
| PubChem CID | 126505880 |
| Molecular Formula | C32H31Cl2F3N6OS |
| Molecular Weight | 675.61 g/mol |
| Exact Mass | 674.16 |
| IUPAC Name | 2-[3-[4-[[7-(4-chloro-3-methoxyphenyl)-1-(4-fluorophenyl)-4,5,6,7-tetrahydrobenzimidazol-2-yl]sulfanylmethyl]-3,5-difluorophenyl]propyl]-1-cyanoguanidine;hydrochloride |
| SMILES | COc1cc(C2CCCc3nc(SCc4c(F)cc(CCC/N=C(\N)NC#N)cc4F)n(-c4ccc(F)cc4)c32)ccc1Cl.Cl |
| InChI | InChI=1S/C32H30ClF3N6OS.ClH/c1-43-29-16-20(7-12-25(29)33)23-5-2-6-28-30(23)42(22-10-8-21(34)9-11-22)32(41-28)44-17-24-26(35)14-19(15-27(24)36)4-3-13-39-31(38)40-18-37;/h7-12,14-16,23H,2-6,13,17H2,1H3,(H3,38,39,40);1H |
| InChIKey | QOCWYGAMDZUWOR-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 101.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.61 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|