C34H35ClF3IN2O3S — CID 126503269
7-(4-chloro-3-methylphenyl)-2-[[2,6-difluoro-3-[2-[2-(2-iodoethoxy)ethoxy]ethoxy]phenyl]methylsulfanyl]-1-(4-fluorophenyl)-7-methyl-5,6-dihydro-4H-benzimidazole (PubChem CID 126503269) has the molecular formula C34H35ClF3IN2O3S and a molecular weight of 771.08 g/mol. Its IUPAC name is 7-(4-chloro-3-methylphenyl)-2-[[2,6-difluoro-3-[2-[2-(2-iodoethoxy)ethoxy]ethoxy]phenyl]methylsulfanyl]-1-(4-fluorophenyl)-7-methyl-5,6-dihydro-4H-benzimidazole.
| Compound Name | 7-(4-chloro-3-methylphenyl)-2-[[2,6-difluoro-3-[2-[2-(2-iodoethoxy)ethoxy]ethoxy]phenyl]methylsulfanyl]-1-(4-fluorophenyl)-7-methyl-5,6-dihydro-4H-benzimidazole |
|---|---|
| PubChem CID | 126503269 |
| Molecular Formula | C34H35ClF3IN2O3S |
| Molecular Weight | 771.08 g/mol |
| Exact Mass | 770.11 |
| IUPAC Name | 7-(4-chloro-3-methylphenyl)-2-[[2,6-difluoro-3-[2-[2-(2-iodoethoxy)ethoxy]ethoxy]phenyl]methylsulfanyl]-1-(4-fluorophenyl)-7-methyl-5,6-dihydro-4H-benzimidazole |
| SMILES | Cc1cc(C2(C)CCCc3nc(SCc4c(F)ccc(OCCOCCOCCI)c4F)n(-c4ccc(F)cc4)c32)ccc1Cl |
| InChI | InChI=1S/C34H35ClF3IN2O3S/c1-22-20-23(5-10-27(22)35)34(2)13-3-4-29-32(34)41(25-8-6-24(36)7-9-25)33(40-29)45-21-26-28(37)11-12-30(31(26)38)44-19-18-43-17-16-42-15-14-39/h5-12,20H,3-4,13-19,21H2,1-2H3 |
| InChIKey | XZONAYPLNMWROZ-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.08 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|