C14H21N3O7 — CID 126504089
(2S)-2-[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]amino]-3-[(6-methyl-3-nitro-2-pyridinyl)oxy]propanoic acid (PubChem CID 126504089) has the molecular formula C14H21N3O7 and a molecular weight of 343.34 g/mol. Its IUPAC name is (2S)-2-[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]amino]-3-[(6-methyl-3-nitro-2-pyridinyl)oxy]propanoic acid.
| Compound Name | (2S)-2-[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]amino]-3-[(6-methyl-3-nitro-2-pyridinyl)oxy]propanoic acid |
|---|---|
| PubChem CID | 126504089 |
| Molecular Formula | C14H21N3O7 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | (2S)-2-[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]amino]-3-[(6-methyl-3-nitro-2-pyridinyl)oxy]propanoic acid |
| SMILES | Cc1ccc([N+](=O)[O-])c(OC[C@H](NC(O)OC(C)(C)C)C(=O)O)n1 |
| InChI | InChI=1S/C14H21N3O7/c1-8-5-6-10(17(21)22)11(15-8)23-7-9(12(18)19)16-13(20)24-14(2,3)4/h5-6,9,13,16,20H,7H2,1-4H3,(H,18,19)/t9-,13?/m0/s1 |
| InChIKey | WBWLHHPJUHKHCS-LLTODGECSA-N |
| XLogP | 0.81 |
| TPSA | 144.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|