C23H28N2O6S — CID 126505956
5-[2-(4-methoxycarbonylphenyl)ethyl-sulfinoamino]-2-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-dihydroisoindole (PubChem CID 126505956) has the molecular formula C23H28N2O6S and a molecular weight of 460.55 g/mol. Its IUPAC name is 5-[2-(4-methoxycarbonylphenyl)ethyl-sulfinoamino]-2-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-dihydroisoindole.
| Compound Name | 5-[2-(4-methoxycarbonylphenyl)ethyl-sulfinoamino]-2-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-dihydroisoindole |
|---|---|
| PubChem CID | 126505956 |
| Molecular Formula | C23H28N2O6S |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 5-[2-(4-methoxycarbonylphenyl)ethyl-sulfinoamino]-2-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-dihydroisoindole |
| SMILES | COC(=O)c1ccc(CCN(c2ccc3c(c2)CN(C(=O)OC(C)(C)C)C3)S(=O)O)cc1 |
| InChI | InChI=1S/C23H28N2O6S/c1-23(2,3)31-22(27)24-14-18-9-10-20(13-19(18)15-24)25(32(28)29)12-11-16-5-7-17(8-6-16)21(26)30-4/h5-10,13H,11-12,14-15H2,1-4H3,(H,28,29) |
| InChIKey | JZFUTXJANIQZNE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|