C28H36O8 — CID 126508479
benzyl 3-(6-ethoxy-6-oxohexoxy)-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]benzoate (PubChem CID 126508479) has the molecular formula C28H36O8 and a molecular weight of 500.59 g/mol. Its IUPAC name is benzyl 3-(6-ethoxy-6-oxohexoxy)-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]benzoate.
| Compound Name | benzyl 3-(6-ethoxy-6-oxohexoxy)-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 126508479 |
| Molecular Formula | C28H36O8 |
| Molecular Weight | 500.59 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | benzyl 3-(6-ethoxy-6-oxohexoxy)-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]benzoate |
| SMILES | CCOC(=O)CCCCCOc1cc(C(=O)OCc2ccccc2)ccc1OCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H36O8/c1-5-32-25(29)14-10-7-11-17-33-24-18-22(27(31)35-19-21-12-8-6-9-13-21)15-16-23(24)34-20-26(30)36-28(2,3)4/h6,8-9,12-13,15-16,18H,5,7,10-11,14,17,19-20H2,1-4H3 |
| InChIKey | HIHNVHCQEJCHLU-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.59 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|