About (1S)-4-[4-(3-hydroxy-3-methylbutoxy)-2,6-dimethylphenyl]-2,3-dihydro-1H-inden-1-ol
(1S)-4-[4-(3-hydroxy-3-methylbutoxy)-2,6-dimethylphenyl]-2,3-dihydro-1H-inden-1-ol (PubChem CID 126511663) has the molecular formula C22H28O3
and a molecular weight of 340.46 g/mol. Its IUPAC name is (1S)-4-[4-(3-hydroxy-3-methylbutoxy)-2,6-dimethylphenyl]-2,3-dihydro-1H-inden-1-ol.
Molecular Properties
| Compound Name | (1S)-4-[4-(3-hydroxy-3-methylbutoxy)-2,6-dimethylphenyl]-2,3-dihydro-1H-inden-1-ol |
| PubChem CID | 126511663 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | (1S)-4-[4-(3-hydroxy-3-methylbutoxy)-2,6-dimethylphenyl]-2,3-dihydro-1H-inden-1-ol |
| SMILES | Cc1cc(OCCC(C)(C)O)cc(C)c1-c1cccc2c1CC[C@@H]2O |
| InChI | InChI=1S/C22H28O3/c1-14-12-16(25-11-10-22(3,4)24)13-15(2)21(14)19-7-5-6-18-17(19)8-9-20(18)23/h5-7,12-13,20,23-24H,8-11H2,1-4H3/t20-/m0/s1 |
| InChIKey | GRPWBGIATFSNGA-FQEVSTJZSA-N |
| XLogP | 4.49 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1S)-4-[4-(3-hydroxy-3-methylbutoxy)-2,6-dimethylphenyl]-2,3-dihydro-1H-inden-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-4-[4-(3-hydroxy-3-methylbutoxy)-2,6-dimethylphenyl]-2,3-dihydro-1H-inden-1-ol?
The IUPAC name of (1S)-4-[4-(3-hydroxy-3-methylbutoxy)-2,6-dimethylphenyl]-2,3-dihydro-1H-inden-1-ol (CID 126511663) is (1S)-4-[4-(3-hydroxy-3-methylbutoxy)-2,6-dimethylphenyl]-2,3-dihydro-1H-inden-1-ol.
What is the SMILES notation for (1S)-4-[4-(3-hydroxy-3-methylbutoxy)-2,6-dimethylphenyl]-2,3-dihydro-1H-inden-1-ol?
The canonical SMILES for (1S)-4-[4-(3-hydroxy-3-methylbutoxy)-2,6-dimethylphenyl]-2,3-dihydro-1H-inden-1-ol is Cc1cc(OCCC(C)(C)O)cc(C)c1-c1cccc2c1CC[C@@H]2O.
What is the InChIKey of (1S)-4-[4-(3-hydroxy-3-methylbutoxy)-2,6-dimethylphenyl]-2,3-dihydro-1H-inden-1-ol?
The InChIKey is GRPWBGIATFSNGA-FQEVSTJZSA-N. The full InChI is InChI=1S/C22H28O3/c1-14-12-16(25-11-10-22(3,4)24)13-15(2)21(14)19-7-5-6-18-17(19)8-9-20(18)23/h5-7,12-13,20,23-24H,8-11H2,1-4H3/t20-/m0/s1.
What are the key properties of (1S)-4-[4-(3-hydroxy-3-methylbutoxy)-2,6-dimethylphenyl]-2,3-dihydro-1H-inden-1-ol?
(1S)-4-[4-(3-hydroxy-3-methylbutoxy)-2,6-dimethylphenyl]-2,3-dihydro-1H-inden-1-ol has a molecular weight of 340.46 g/mol, XLogP of 4.49, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-4-[4-(3-hydroxy-3-methylbutoxy)-2,6-dimethylphenyl]-2,3-dihydro-1H-inden-1-ol is sourced from PubChem (CID 126511663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).