C24H30O10 — CID 126512857
[(1R,4R,6S,9S)-4-hydroxy-6-methyl-8-oxo-1-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]-7-oxatricyclo[4.3.0.03,9]nonan-9-yl]methyl benzoate (PubChem CID 126512857) has the molecular formula C24H30O10 and a molecular weight of 478.49 g/mol. Its IUPAC name is [(1R,4R,6S,9S)-4-hydroxy-6-methyl-8-oxo-1-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]-7-oxatricyclo[4.3.0.03,9]nonan-9-yl]methyl benzoate.
| Compound Name | [(1R,4R,6S,9S)-4-hydroxy-6-methyl-8-oxo-1-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]-7-oxatricyclo[4.3.0.03,9]nonan-9-yl]methyl benzoate |
|---|---|
| PubChem CID | 126512857 |
| Molecular Formula | C24H30O10 |
| Molecular Weight | 478.49 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | [(1R,4R,6S,9S)-4-hydroxy-6-methyl-8-oxo-1-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methyl]-7-oxatricyclo[4.3.0.03,9]nonan-9-yl]methyl benzoate |
| SMILES | C[C@]12C[C@@H](O)C3C[C@@]1(CC1OC(CO)C(O)C(O)C1O)[C@@]3(COC(=O)c1ccccc1)C(=O)O2 |
| InChI | InChI=1S/C24H30O10/c1-22-8-14(26)13-7-23(22,9-15-17(27)19(29)18(28)16(10-25)33-15)24(13,21(31)34-22)11-32-20(30)12-5-3-2-4-6-12/h2-6,13-19,25-29H,7-11H2,1H3/t13?,14-,15?,16?,17?,18?,19?,22+,23+,24-/m1/s1 |
| InChIKey | DMJNEEQJBDENAK-CHYVAJCDSA-N |
| XLogP | -0.85 |
| TPSA | 162.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.49 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |