C9H11NO4 — CID 126512858
(6S)-6-amino-6-hydroxy-3-methylidene-3a,4,7,7a-tetrahydro-1-benzofuran-2,5-dione (PubChem CID 126512858) has the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. Its IUPAC name is (6S)-6-amino-6-hydroxy-3-methylidene-3a,4,7,7a-tetrahydro-1-benzofuran-2,5-dione.
| Compound Name | (6S)-6-amino-6-hydroxy-3-methylidene-3a,4,7,7a-tetrahydro-1-benzofuran-2,5-dione |
|---|---|
| PubChem CID | 126512858 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | (6S)-6-amino-6-hydroxy-3-methylidene-3a,4,7,7a-tetrahydro-1-benzofuran-2,5-dione |
| SMILES | C=C1C(=O)OC2C[C@](N)(O)C(=O)CC12 |
| InChI | InChI=1S/C9H11NO4/c1-4-5-2-7(11)9(10,13)3-6(5)14-8(4)12/h5-6,13H,1-3,10H2/t5?,6?,9-/m0/s1 |
| InChIKey | ICLADDFYBSXNFC-BIFUPNIPSA-N |
| XLogP | -0.91 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|