C10H19Cl2O2P — CID 12651394
1-[butyl(2,2-dichloroethenoxy)phosphoryl]butane (PubChem CID 12651394) has the molecular formula C10H19Cl2O2P and a molecular weight of 273.14 g/mol. Its IUPAC name is 1-[butyl(2,2-dichloroethenoxy)phosphoryl]butane.
| Compound Name | 1-[butyl(2,2-dichloroethenoxy)phosphoryl]butane |
|---|---|
| PubChem CID | 12651394 |
| Molecular Formula | C10H19Cl2O2P |
| Molecular Weight | 273.14 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 1-[butyl(2,2-dichloroethenoxy)phosphoryl]butane |
| SMILES | CCCCP(=O)(CCCC)OC=C(Cl)Cl |
| InChI | InChI=1S/C10H19Cl2O2P/c1-3-5-7-15(13,8-6-4-2)14-9-10(11)12/h9H,3-8H2,1-2H3 |
| InChIKey | NJLMHLMEGJNCLN-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.14 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|