C9H17Cl2O3P — CID 23261074
1,1-dichloro-2-[propan-2-yl(propan-2-yloxy)phosphoryl]oxyprop-1-ene (PubChem CID 23261074) has the molecular formula C9H17Cl2O3P and a molecular weight of 275.11 g/mol. Its IUPAC name is 1,1-dichloro-2-[propan-2-yl(propan-2-yloxy)phosphoryl]oxyprop-1-ene.
| Compound Name | 1,1-dichloro-2-[propan-2-yl(propan-2-yloxy)phosphoryl]oxyprop-1-ene |
|---|---|
| PubChem CID | 23261074 |
| Molecular Formula | C9H17Cl2O3P |
| Molecular Weight | 275.11 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | 1,1-dichloro-2-[propan-2-yl(propan-2-yloxy)phosphoryl]oxyprop-1-ene |
| SMILES | CC(OP(=O)(OC(C)C)C(C)C)=C(Cl)Cl |
| InChI | InChI=1S/C9H17Cl2O3P/c1-6(2)13-15(12,7(3)4)14-8(5)9(10)11/h6-7H,1-5H3 |
| InChIKey | FCOIXFYRZGSVKW-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.11 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|