C5H8Cl2O3P+ — CID 23262847
1,1-dichloroprop-1-en-2-yloxy-ethoxy-oxophosphanium (PubChem CID 23262847) has the molecular formula C5H8Cl2O3P+ and a molecular weight of 218.00 g/mol. Its IUPAC name is 1,1-dichloroprop-1-en-2-yloxy-ethoxy-oxophosphanium.
| Compound Name | 1,1-dichloroprop-1-en-2-yloxy-ethoxy-oxophosphanium |
|---|---|
| PubChem CID | 23262847 |
| Molecular Formula | C5H8Cl2O3P+ |
| Molecular Weight | 218.00 g/mol |
| Exact Mass | 216.96 |
| IUPAC Name | 1,1-dichloroprop-1-en-2-yloxy-ethoxy-oxophosphanium |
| SMILES | CCO[P+](=O)OC(C)=C(Cl)Cl |
| InChI | InChI=1S/C5H8Cl2O3P/c1-3-9-11(8)10-4(2)5(6)7/h3H2,1-2H3/q+1 |
| InChIKey | WWFAJWUIEQXDQO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.00 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|