C23H20F3IN4O2 — CID 126514231
4-[6,6-dimethyl-4-oxo-3-(trifluoromethyl)-5,7-dihydroindazol-1-yl]-2-(4-iodoanilino)benzamide (PubChem CID 126514231) has the molecular formula C23H20F3IN4O2 and a molecular weight of 568.34 g/mol. Its IUPAC name is 4-[6,6-dimethyl-4-oxo-3-(trifluoromethyl)-5,7-dihydroindazol-1-yl]-2-(4-iodoanilino)benzamide.
| Compound Name | 4-[6,6-dimethyl-4-oxo-3-(trifluoromethyl)-5,7-dihydroindazol-1-yl]-2-(4-iodoanilino)benzamide |
|---|---|
| PubChem CID | 126514231 |
| Molecular Formula | C23H20F3IN4O2 |
| Molecular Weight | 568.34 g/mol |
| Exact Mass | 568.06 |
| IUPAC Name | 4-[6,6-dimethyl-4-oxo-3-(trifluoromethyl)-5,7-dihydroindazol-1-yl]-2-(4-iodoanilino)benzamide |
| SMILES | CC1(C)CC(=O)c2c(C(F)(F)F)nn(-c3ccc(C(N)=O)c(Nc4ccc(I)cc4)c3)c2C1 |
| InChI | InChI=1S/C23H20F3IN4O2/c1-22(2)10-17-19(18(32)11-22)20(23(24,25)26)30-31(17)14-7-8-15(21(28)33)16(9-14)29-13-5-3-12(27)4-6-13/h3-9,29H,10-11H2,1-2H3,(H2,28,33) |
| InChIKey | HEICMARICMPAMG-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.34 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|