C17H17F3N4O2 — CID 70283154
2-amino-4-[6,6-dimethyl-4-oxo-3-(trifluoromethyl)-5,7-dihydroindazol-1-yl]benzamide (PubChem CID 70283154) has the molecular formula C17H17F3N4O2 and a molecular weight of 366.34 g/mol. Its IUPAC name is 2-amino-4-[6,6-dimethyl-4-oxo-3-(trifluoromethyl)-5,7-dihydroindazol-1-yl]benzamide.
| Compound Name | 2-amino-4-[6,6-dimethyl-4-oxo-3-(trifluoromethyl)-5,7-dihydroindazol-1-yl]benzamide |
|---|---|
| PubChem CID | 70283154 |
| Molecular Formula | C17H17F3N4O2 |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 2-amino-4-[6,6-dimethyl-4-oxo-3-(trifluoromethyl)-5,7-dihydroindazol-1-yl]benzamide |
| SMILES | CC1(C)CC(=O)c2c(C(F)(F)F)nn(-c3ccc(C(N)=O)c(N)c3)c2C1 |
| InChI | InChI=1S/C17H17F3N4O2/c1-16(2)6-11-13(12(25)7-16)14(17(18,19)20)23-24(11)8-3-4-9(15(22)26)10(21)5-8/h3-5H,6-7,21H2,1-2H3,(H2,22,26) |
| InChIKey | NRDWTUHVWITXCR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 104.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|