C33H48IN5O2S — CID 126515076
N-[(2S)-1-[4-[iodomethyl(propyl)amino]piperidin-1-yl]-4-methyl-1-oxopentan-2-yl]-1-pentan-3-yl-2-(thiophen-2-ylmethyl)benzimidazole-5-carboxamide (PubChem CID 126515076) has the molecular formula C33H48IN5O2S and a molecular weight of 705.75 g/mol. Its IUPAC name is N-[(2S)-1-[4-[iodomethyl(propyl)amino]piperidin-1-yl]-4-methyl-1-oxopentan-2-yl]-1-pentan-3-yl-2-(thiophen-2-ylmethyl)benzimidazole-5-carboxamide.
| Compound Name | N-[(2S)-1-[4-[iodomethyl(propyl)amino]piperidin-1-yl]-4-methyl-1-oxopentan-2-yl]-1-pentan-3-yl-2-(thiophen-2-ylmethyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 126515076 |
| Molecular Formula | C33H48IN5O2S |
| Molecular Weight | 705.75 g/mol |
| Exact Mass | 705.26 |
| IUPAC Name | N-[(2S)-1-[4-[iodomethyl(propyl)amino]piperidin-1-yl]-4-methyl-1-oxopentan-2-yl]-1-pentan-3-yl-2-(thiophen-2-ylmethyl)benzimidazole-5-carboxamide |
| SMILES | CCCN(CI)C1CCN(C(=O)[C@H](CC(C)C)NC(=O)c2ccc3c(c2)nc(Cc2cccs2)n3C(CC)CC)CC1 |
| InChI | InChI=1S/C33H48IN5O2S/c1-6-15-38(22-34)26-13-16-37(17-14-26)33(41)29(19-23(4)5)36-32(40)24-11-12-30-28(20-24)35-31(21-27-10-9-18-42-27)39(30)25(7-2)8-3/h9-12,18,20,23,25-26,29H,6-8,13-17,19,21-22H2,1-5H3,(H,36,40)/t29-/m0/s1 |
| InChIKey | QFGJRBRCRZIGNT-LJAQVGFWSA-N |
| XLogP | 7.29 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.75 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|