C30H40N4O4S — CID 90083859
(2S)-1-[(2S)-4-methyl-2-[[1-pentan-3-yl-2-(thiophen-2-ylmethyl)benzimidazole-5-carbonyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 90083859) has the molecular formula C30H40N4O4S and a molecular weight of 552.74 g/mol. Its IUPAC name is (2S)-1-[(2S)-4-methyl-2-[[1-pentan-3-yl-2-(thiophen-2-ylmethyl)benzimidazole-5-carbonyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(2S)-4-methyl-2-[[1-pentan-3-yl-2-(thiophen-2-ylmethyl)benzimidazole-5-carbonyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 90083859 |
| Molecular Formula | C30H40N4O4S |
| Molecular Weight | 552.74 g/mol |
| Exact Mass | 552.28 |
| IUPAC Name | (2S)-1-[(2S)-4-methyl-2-[[1-pentan-3-yl-2-(thiophen-2-ylmethyl)benzimidazole-5-carbonyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CCC(C)C[C@H](NC(=O)c1ccc2c(c1)nc(Cc1cccs1)n2C(CC)CC)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C30H40N4O4S/c1-5-19(4)16-24(29(36)33-14-8-11-26(33)30(37)38)32-28(35)20-12-13-25-23(17-20)31-27(18-22-10-9-15-39-22)34(25)21(6-2)7-3/h9-10,12-13,15,17,19,21,24,26H,5-8,11,14,16,18H2,1-4H3,(H,32,35)(H,37,38)/t19?,24-,26-/m0/s1 |
| InChIKey | OCHBGEXNRAYSTN-HFKVKABFSA-N |
| XLogP | 5.66 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.74 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |