C35H46N4O3S — CID 126515123
N-[5-methyl-1-oxo-1-(3-phenylmethoxypropylamino)hexan-2-yl]-1-pentan-3-yl-2-(thiophen-2-ylmethyl)benzimidazole-5-carboxamide (PubChem CID 126515123) has the molecular formula C35H46N4O3S and a molecular weight of 602.85 g/mol. Its IUPAC name is N-[5-methyl-1-oxo-1-(3-phenylmethoxypropylamino)hexan-2-yl]-1-pentan-3-yl-2-(thiophen-2-ylmethyl)benzimidazole-5-carboxamide.
| Compound Name | N-[5-methyl-1-oxo-1-(3-phenylmethoxypropylamino)hexan-2-yl]-1-pentan-3-yl-2-(thiophen-2-ylmethyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 126515123 |
| Molecular Formula | C35H46N4O3S |
| Molecular Weight | 602.85 g/mol |
| Exact Mass | 602.33 |
| IUPAC Name | N-[5-methyl-1-oxo-1-(3-phenylmethoxypropylamino)hexan-2-yl]-1-pentan-3-yl-2-(thiophen-2-ylmethyl)benzimidazole-5-carboxamide |
| SMILES | CCC(CC)n1c(Cc2cccs2)nc2cc(C(=O)NC(CCC(C)C)C(=O)NCCCOCc3ccccc3)ccc21 |
| InChI | InChI=1S/C35H46N4O3S/c1-5-28(6-2)39-32-18-16-27(22-31(32)37-33(39)23-29-14-10-21-43-29)34(40)38-30(17-15-25(3)4)35(41)36-19-11-20-42-24-26-12-8-7-9-13-26/h7-10,12-14,16,18,21-22,25,28,30H,5-6,11,15,17,19-20,23-24H2,1-4H3,(H,36,41)(H,38,40) |
| InChIKey | OEQUGTSERIKQQB-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.85 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|