C31H47N5O2S — CID 126515260
N-[(2S)-1-[4-(diethylamino)butylamino]-1-oxopentan-2-yl]-1-pentan-3-yl-2-(thiophen-2-ylmethyl)benzimidazole-5-carboxamide (PubChem CID 126515260) has the molecular formula C31H47N5O2S and a molecular weight of 553.82 g/mol. Its IUPAC name is N-[(2S)-1-[4-(diethylamino)butylamino]-1-oxopentan-2-yl]-1-pentan-3-yl-2-(thiophen-2-ylmethyl)benzimidazole-5-carboxamide.
| Compound Name | N-[(2S)-1-[4-(diethylamino)butylamino]-1-oxopentan-2-yl]-1-pentan-3-yl-2-(thiophen-2-ylmethyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 126515260 |
| Molecular Formula | C31H47N5O2S |
| Molecular Weight | 553.82 g/mol |
| Exact Mass | 553.35 |
| IUPAC Name | N-[(2S)-1-[4-(diethylamino)butylamino]-1-oxopentan-2-yl]-1-pentan-3-yl-2-(thiophen-2-ylmethyl)benzimidazole-5-carboxamide |
| SMILES | CCC[C@H](NC(=O)c1ccc2c(c1)nc(Cc1cccs1)n2C(CC)CC)C(=O)NCCCCN(CC)CC |
| InChI | InChI=1S/C31H47N5O2S/c1-6-14-26(31(38)32-18-11-12-19-35(9-4)10-5)34-30(37)23-16-17-28-27(21-23)33-29(22-25-15-13-20-39-25)36(28)24(7-2)8-3/h13,15-17,20-21,24,26H,6-12,14,18-19,22H2,1-5H3,(H,32,38)(H,34,37)/t26-/m0/s1 |
| InChIKey | DGQVZPIJQZOQSY-SANMLTNESA-N |
| XLogP | 6.19 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.82 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|