C16H20N2O3 — CID 126515191
[(1R,6S)-6-(2-pyridin-4-ylethylcarbamoyl)cyclohex-3-en-1-yl] acetate (PubChem CID 126515191) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is [(1R,6S)-6-(2-pyridin-4-ylethylcarbamoyl)cyclohex-3-en-1-yl] acetate.
| Compound Name | [(1R,6S)-6-(2-pyridin-4-ylethylcarbamoyl)cyclohex-3-en-1-yl] acetate |
|---|---|
| PubChem CID | 126515191 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | [(1R,6S)-6-(2-pyridin-4-ylethylcarbamoyl)cyclohex-3-en-1-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC=CC[C@@H]1C(=O)NCCc1ccncc1 |
| InChI | InChI=1S/C16H20N2O3/c1-12(19)21-15-5-3-2-4-14(15)16(20)18-11-8-13-6-9-17-10-7-13/h2-3,6-7,9-10,14-15H,4-5,8,11H2,1H3,(H,18,20)/t14-,15+/m0/s1 |
| InChIKey | XIXNEROQBRIDRL-LSDHHAIUSA-N |
| XLogP | 1.64 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|