C11H21FN2O — CID 126517839
4-(3-fluoropiperidin-4-yl)-2,6-dimethylmorpholine (PubChem CID 126517839) has the molecular formula C11H21FN2O and a molecular weight of 216.30 g/mol. Its IUPAC name is 4-(3-fluoropiperidin-4-yl)-2,6-dimethylmorpholine.
| Compound Name | 4-(3-fluoropiperidin-4-yl)-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 126517839 |
| Molecular Formula | C11H21FN2O |
| Molecular Weight | 216.30 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 4-(3-fluoropiperidin-4-yl)-2,6-dimethylmorpholine |
| SMILES | CC1CN(C2CCNCC2F)CC(C)O1 |
| InChI | InChI=1S/C11H21FN2O/c1-8-6-14(7-9(2)15-8)11-3-4-13-5-10(11)12/h8-11,13H,3-7H2,1-2H3 |
| InChIKey | SSOKJKBMAHDJOG-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.30 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |