C11H14BrFN2O2 — CID 126518804
[1-(3-bromo-5-fluorophenyl)-2-(dimethylamino)ethyl] carbamate (PubChem CID 126518804) has the molecular formula C11H14BrFN2O2 and a molecular weight of 305.15 g/mol. Its IUPAC name is [1-(3-bromo-5-fluorophenyl)-2-(dimethylamino)ethyl] carbamate.
| Compound Name | [1-(3-bromo-5-fluorophenyl)-2-(dimethylamino)ethyl] carbamate |
|---|---|
| PubChem CID | 126518804 |
| Molecular Formula | C11H14BrFN2O2 |
| Molecular Weight | 305.15 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | [1-(3-bromo-5-fluorophenyl)-2-(dimethylamino)ethyl] carbamate |
| SMILES | CN(C)CC(OC(N)=O)c1cc(F)cc(Br)c1 |
| InChI | InChI=1S/C11H14BrFN2O2/c1-15(2)6-10(17-11(14)16)7-3-8(12)5-9(13)4-7/h3-5,10H,6H2,1-2H3,(H2,14,16) |
| InChIKey | VFPIKKIBCCUTTP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.15 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |