C12H16N4 — CID 126518807
4-(4-methylpiperazin-1-yl)-1H-pyrrolo[3,2-c]pyridine (PubChem CID 126518807) has the molecular formula C12H16N4 and a molecular weight of 216.29 g/mol. Its IUPAC name is 4-(4-methylpiperazin-1-yl)-1H-pyrrolo[3,2-c]pyridine.
| Compound Name | 4-(4-methylpiperazin-1-yl)-1H-pyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 126518807 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 4-(4-methylpiperazin-1-yl)-1H-pyrrolo[3,2-c]pyridine |
| SMILES | CN1CCN(c2nccc3[nH]ccc23)CC1 |
| InChI | InChI=1S/C12H16N4/c1-15-6-8-16(9-7-15)12-10-2-4-13-11(10)3-5-14-12/h2-5,13H,6-9H2,1H3 |
| InChIKey | UPPUYSJHEDJKMW-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |