C12H16N4S2 — CID 161254865
S-[4-(4-methylpiperazin-1-yl)thieno[3,2-c]pyridin-2-yl]thiohydroxylamine (PubChem CID 161254865) has the molecular formula C12H16N4S2 and a molecular weight of 280.42 g/mol. Its IUPAC name is S-[4-(4-methylpiperazin-1-yl)thieno[3,2-c]pyridin-2-yl]thiohydroxylamine.
| Compound Name | S-[4-(4-methylpiperazin-1-yl)thieno[3,2-c]pyridin-2-yl]thiohydroxylamine |
|---|---|
| PubChem CID | 161254865 |
| Molecular Formula | C12H16N4S2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | S-[4-(4-methylpiperazin-1-yl)thieno[3,2-c]pyridin-2-yl]thiohydroxylamine |
| SMILES | CN1CCN(c2nccc3sc(SN)cc23)CC1 |
| InChI | InChI=1S/C12H16N4S2/c1-15-4-6-16(7-5-15)12-9-8-11(18-13)17-10(9)2-3-14-12/h2-3,8H,4-7,13H2,1H3 |
| InChIKey | WRMWXYBGJYSXLG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|