C15H14BrClIN3OS — CID 126519200
1-[2-[(4-amino-2-bromophenyl)sulfanylmethyl]-3-chlorophenyl]-3-(iodomethyl)urea (PubChem CID 126519200) has the molecular formula C15H14BrClIN3OS and a molecular weight of 526.63 g/mol. Its IUPAC name is 1-[2-[(4-amino-2-bromophenyl)sulfanylmethyl]-3-chlorophenyl]-3-(iodomethyl)urea.
| Compound Name | 1-[2-[(4-amino-2-bromophenyl)sulfanylmethyl]-3-chlorophenyl]-3-(iodomethyl)urea |
|---|---|
| PubChem CID | 126519200 |
| Molecular Formula | C15H14BrClIN3OS |
| Molecular Weight | 526.63 g/mol |
| Exact Mass | 524.88 |
| IUPAC Name | 1-[2-[(4-amino-2-bromophenyl)sulfanylmethyl]-3-chlorophenyl]-3-(iodomethyl)urea |
| SMILES | Nc1ccc(SCc2c(Cl)cccc2NC(=O)NCI)c(Br)c1 |
| InChI | InChI=1S/C15H14BrClIN3OS/c16-11-6-9(19)4-5-14(11)23-7-10-12(17)2-1-3-13(10)21-15(22)20-8-18/h1-6H,7-8,19H2,(H2,20,21,22) |
| InChIKey | NMOOGBQAYPAIIF-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.63 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|