C19H27N3O3 — CID 126522706
3-amino-2-tert-butyl-5-(5-methoxy-1H-indol-3-yl)piperidine-1-carboxylic acid (PubChem CID 126522706) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is 3-amino-2-tert-butyl-5-(5-methoxy-1H-indol-3-yl)piperidine-1-carboxylic acid.
| Compound Name | 3-amino-2-tert-butyl-5-(5-methoxy-1H-indol-3-yl)piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 126522706 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 3-amino-2-tert-butyl-5-(5-methoxy-1H-indol-3-yl)piperidine-1-carboxylic acid |
| SMILES | COc1ccc2[nH]cc(C3CC(N)C(C(C)(C)C)N(C(=O)O)C3)c2c1 |
| InChI | InChI=1S/C19H27N3O3/c1-19(2,3)17-15(20)7-11(10-22(17)18(23)24)14-9-21-16-6-5-12(25-4)8-13(14)16/h5-6,8-9,11,15,17,21H,7,10,20H2,1-4H3,(H,23,24) |
| InChIKey | YIQGVTGUOCLRTM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 91.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |