C22H17ClFN3 — CID 126531696
3-chloro-N-[1-(2-fluoro-5-pyridin-4-ylphenyl)ethyl]quinolin-4-amine (PubChem CID 126531696) has the molecular formula C22H17ClFN3 and a molecular weight of 377.85 g/mol. Its IUPAC name is 3-chloro-N-[1-(2-fluoro-5-pyridin-4-ylphenyl)ethyl]quinolin-4-amine.
| Compound Name | 3-chloro-N-[1-(2-fluoro-5-pyridin-4-ylphenyl)ethyl]quinolin-4-amine |
|---|---|
| PubChem CID | 126531696 |
| Molecular Formula | C22H17ClFN3 |
| Molecular Weight | 377.85 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 3-chloro-N-[1-(2-fluoro-5-pyridin-4-ylphenyl)ethyl]quinolin-4-amine |
| SMILES | CC(Nc1c(Cl)cnc2ccccc12)c1cc(-c2ccncc2)ccc1F |
| InChI | InChI=1S/C22H17ClFN3/c1-14(27-22-17-4-2-3-5-21(17)26-13-19(22)23)18-12-16(6-7-20(18)24)15-8-10-25-11-9-15/h2-14H,1H3,(H,26,27) |
| InChIKey | UWKAKHUNTPGXPM-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.85 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |