C20H20ClFN2O — CID 126531971
3-[3-[1-[(3-chloroquinolin-4-yl)amino]ethyl]-4-fluorophenyl]propan-1-ol (PubChem CID 126531971) has the molecular formula C20H20ClFN2O and a molecular weight of 358.84 g/mol. Its IUPAC name is 3-[3-[1-[(3-chloroquinolin-4-yl)amino]ethyl]-4-fluorophenyl]propan-1-ol.
| Compound Name | 3-[3-[1-[(3-chloroquinolin-4-yl)amino]ethyl]-4-fluorophenyl]propan-1-ol |
|---|---|
| PubChem CID | 126531971 |
| Molecular Formula | C20H20ClFN2O |
| Molecular Weight | 358.84 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 3-[3-[1-[(3-chloroquinolin-4-yl)amino]ethyl]-4-fluorophenyl]propan-1-ol |
| SMILES | CC(Nc1c(Cl)cnc2ccccc12)c1cc(CCCO)ccc1F |
| InChI | InChI=1S/C20H20ClFN2O/c1-13(16-11-14(5-4-10-25)8-9-18(16)22)24-20-15-6-2-3-7-19(15)23-12-17(20)21/h2-3,6-9,11-13,25H,4-5,10H2,1H3,(H,23,24) |
| InChIKey | MAZXWTHASVJPTC-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.84 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |