C14H13BrFNO4 — CID 126532251
5-[1-(4-bromo-2-fluoroanilino)ethylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 126532251) has the molecular formula C14H13BrFNO4 and a molecular weight of 358.16 g/mol. Its IUPAC name is 5-[1-(4-bromo-2-fluoroanilino)ethylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[1-(4-bromo-2-fluoroanilino)ethylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 126532251 |
| Molecular Formula | C14H13BrFNO4 |
| Molecular Weight | 358.16 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | 5-[1-(4-bromo-2-fluoroanilino)ethylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC(Nc1ccc(Br)cc1F)=C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C14H13BrFNO4/c1-7(17-10-5-4-8(15)6-9(10)16)11-12(18)20-14(2,3)21-13(11)19/h4-6,17H,1-3H3 |
| InChIKey | LHZUXISNKAOYMB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.16 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|