C25H24ClFN4O — CID 126532390
2-[5-[3-chloro-4-[1-(2-fluorophenyl)propylamino]quinolin-6-yl]pyrimidin-2-yl]propan-2-ol (PubChem CID 126532390) has the molecular formula C25H24ClFN4O and a molecular weight of 450.95 g/mol. Its IUPAC name is 2-[5-[3-chloro-4-[1-(2-fluorophenyl)propylamino]quinolin-6-yl]pyrimidin-2-yl]propan-2-ol.
| Compound Name | 2-[5-[3-chloro-4-[1-(2-fluorophenyl)propylamino]quinolin-6-yl]pyrimidin-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 126532390 |
| Molecular Formula | C25H24ClFN4O |
| Molecular Weight | 450.95 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 2-[5-[3-chloro-4-[1-(2-fluorophenyl)propylamino]quinolin-6-yl]pyrimidin-2-yl]propan-2-ol |
| SMILES | CCC(Nc1c(Cl)cnc2ccc(-c3cnc(C(C)(C)O)nc3)cc12)c1ccccc1F |
| InChI | InChI=1S/C25H24ClFN4O/c1-4-21(17-7-5-6-8-20(17)27)31-23-18-11-15(9-10-22(18)28-14-19(23)26)16-12-29-24(30-13-16)25(2,3)32/h5-14,21,32H,4H2,1-3H3,(H,28,31) |
| InChIKey | SCELQBVHISIVJG-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.95 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |